|
CAS#: 73758-45-9 Product: 3-(3,4-Dimethoxyphenyl)Butan-1-Amine Hydrochloride No suppilers available for the product. |
| Name | 3-(3,4-Dimethoxyphenyl)Butan-1-Amine Hydrochloride |
|---|---|
| Synonyms | 3-(3,4-Dimethoxyphenyl)Butylamine Hydrochloride; Butylamine, 3-(3,4-Dimethoxyphenyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 |
| CAS Registry Number | 73758-45-9 |
| SMILES | [H+].C1=C(OC)C(=CC=C1C(CCN)C)OC.[Cl-] |
| InChI | 1S/C12H19NO2.ClH/c1-9(6-7-13)10-4-5-11(14-2)12(8-10)15-3;/h4-5,8-9H,6-7,13H2,1-3H3;1H |
| InChIKey | DTGUXVDMPVMFLE-UHFFFAOYSA-N |
| Boiling point | 305.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 151.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,4-Dimethoxyphenyl)Butan-1-Amine Hydrochloride |