|
CAS#: 73771-51-4 Product: 2-Methyl-6-Phenyloxireno(4,5)Pyrano(3,2-d)-m-Dioxin No suppilers available for the product. |
| Name | 2-Methyl-6-Phenyloxireno(4,5)Pyrano(3,2-d)-m-Dioxin |
|---|---|
| Synonyms | Oxireno(4.5)Pyrano(3.2-D)-M-Dioxin, 2-Methoxy-6-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 |
| CAS Registry Number | 73771-51-4 |
| SMILES | C4=C(C3OC=C1C(=C2C(=C(O1)OC)O2)O3)C=CC=C4 |
| InChI | 1S/C14H10O5/c1-15-14-12-11(18-12)10-9(17-14)7-16-13(19-10)8-5-3-2-4-6-8/h2-7,13H,1H3 |
| InChIKey | WNAICBLIPNPBMG-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.764°C at 760 mmHg (Cal.) |
| Flash point | 187.068°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-6-Phenyloxireno(4,5)Pyrano(3,2-d)-m-Dioxin |