|
CAS#: 73771-73-0 Product: 6-Fluoro-3-Methylcholanthrene No suppilers available for the product. |
| Name | 6-Fluoro-3-Methylcholanthrene |
|---|---|
| Synonyms | Benz(J)Aceanthrylene, 1,2-Dihydro-6-Fluoro-3-Methyl-; Cholanthrene, 6-Fluoro-3-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H15F |
| Molecular Weight | 286.35 |
| CAS Registry Number | 73771-73-0 |
| SMILES | C1=C(C5=C4C(=C1)C(=C3C2=CC=CC=C2C=CC3=C4CC5)F)C |
| InChI | 1S/C21H15F/c1-12-6-8-18-19-14(12)10-11-16(19)17-9-7-13-4-2-3-5-15(13)20(17)21(18)22/h2-9H,10-11H2,1H3 |
| InChIKey | PYGFTQSWNOAFAN-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.114°C at 760 mmHg (Cal.) |
| Flash point | 227.031°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Fluoro-3-Methylcholanthrene |