|
CAS#: 73791-42-1 Product: (4-Chlorophenyl)-Methylarsinic Acid No suppilers available for the product. |
| Name | (4-Chlorophenyl)-Methylarsinic Acid |
|---|---|
| Synonyms | (4-Chlorophenyl)-Methyl-Arsinic Acid; (4-Chlorophenyl)Methylarsinic Acid; (P-Chlorophenyl)Hydroxymethylarsine Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8AsClO2 |
| Molecular Weight | 234.51 |
| CAS Registry Number | 73791-42-1 |
| SMILES | C1=CC(=CC=C1[As](C)(O)=O)Cl |
| InChI | 1S/C7H8AsClO2/c1-8(10,11)6-2-4-7(9)5-3-6/h2-5H,1H3,(H,10,11) |
| InChIKey | BPAWXYPNIBALJH-UHFFFAOYSA-N |
| Boiling point | 376.909°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 181.748°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Chlorophenyl)-Methylarsinic Acid |