Online Database of Chemicals from Around the World
|
CAS#: 73825-70-4 Product: N-(3-Chlorophenyl)-2-(3-Chlorophenyl)Iminocyclopentane-1-Carboxamide No suppilers available for the product. |
| Name | N-(3-Chlorophenyl)-2-(3-Chlorophenyl)Iminocyclopentane-1-Carboxamide |
|---|---|
| Synonyms | N-(3-Chlorophenyl)-2-(3-Chlorophenyl)Imino-Cyclopentane-1-Carboxamide; N-(3-Chlorophenyl)-2-(3-Chlorophenyl)Imino-1-Cyclopentanecarboxamide; 3'-Chloro-2-[(M-Chlorophenyl)Imino]Cyclopentanecarboxanilide |
| Molecular Structure |  |
| Molecular Formula | C18H16Cl2N2O |
| Molecular Weight | 347.24 |
| CAS Registry Number | 73825-70-4 |
| SMILES | C1=C(Cl)C=CC=C1N=C3C(C(NC2=CC=CC(=C2)Cl)=O)CCC3 |
| InChI | 1S/C18H16Cl2N2O/c19-12-4-1-6-14(10-12)21-17-9-3-8-16(17)18(23)22-15-7-2-5-13(20)11-15/h1-2,4-7,10-11,16H,3,8-9H2,(H,22,23) |
| InChIKey | AGXFOJPZNKUIGM-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.075°C at 760 mmHg (Cal.) |
| Flash point | 282.242°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Chlorophenyl)-2-(3-Chlorophenyl)Iminocyclopentane-1-Carboxamide |