Online Database of Chemicals from Around the World
| Name | 1,1,1,3,3,3-Hexafluoro-2-(2,2,2-Trifluoroethoxy)Propan-2-Ol |
|---|---|
| Synonyms | 1,1,1,3,3,3-Hexafluoro-2-(2,2,2-Trifluoroethoxy)-2-Propanol; 2-(2,2,2-Trifluoroethoxy)-1,1,1,3,3,3-Hexafluoro-2-Propanol; 2-Propanol, 1,1,1,3,3,3-Hexafluoro-2-(2,2,2-Trifluoroethoxy)- |
| Molecular Structure |  |
| Molecular Formula | C5H3F9O2 |
| Molecular Weight | 266.06 |
| CAS Registry Number | 73825-97-5 |
| SMILES | C(OC(O)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C5H3F9O2/c6-2(7,8)1-16-3(15,4(9,10)11)5(12,13)14/h15H,1H2 |
| InChIKey | GWKLAAZIVXDZKM-UHFFFAOYSA-N |
| Density | 1.621g/cm3 (Cal.) |
|---|---|
| Boiling point | 126.467°C at 760 mmHg (Cal.) |
| Flash point | 66.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,3,3-Hexafluoro-2-(2,2,2-Trifluoroethoxy)Propan-2-Ol |
