|
CAS#: 73839-82-4 Product: Dinaphthalen-2-Yl (Z)-But-2-Enedioate No suppilers available for the product. |
| Name | Dinaphthalen-2-Yl (Z)-But-2-Enedioate |
|---|---|
| Synonyms | Bis(2-Naphthyl) (Z)-But-2-Enedioate; (Z)-But-2-Enedioic Acid Bis(2-Naphthyl) Ester; Brn 2544374 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H16O4 |
| Molecular Weight | 368.39 |
| CAS Registry Number | 73839-82-4 |
| SMILES | C1=C4C(=CC=C1OC(\C=C/C(OC2=CC=C3C(=C2)C=CC=C3)=O)=O)C=CC=C4 |
| InChI | 1S/C24H16O4/c25-23(27-21-11-9-17-5-1-3-7-19(17)15-21)13-14-24(26)28-22-12-10-18-6-2-4-8-20(18)16-22/h1-16H/b14-13- |
| InChIKey | OQTWKMMWTVEVPX-YPKPFQOOSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 580.611°C at 760 mmHg (Cal.) |
| Flash point | 301.671°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dinaphthalen-2-Yl (Z)-But-2-Enedioate |