|
CAS#: 73840-18-3 Product: 1-(4-Bromophenyl)-3-(4-Nitrophenyl)-1,3-Diazetidine-2,4-Dione No suppilers available for the product. |
| Name | 1-(4-Bromophenyl)-3-(4-Nitrophenyl)-1,3-Diazetidine-2,4-Dione |
|---|---|
| Synonyms | 1-(4-Bromophenyl)-3-(4-Nitrophenyl)-1,3-Diazetidine-2,4-Quinone; 1-(P-Bromophenyl)-3-(P-Nitrophenyl)Uretidinedione; 2,4-Uretidinedione, 1-(P-Bromophenyl)-3-(P-Nitrophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8BrN3O4 |
| Molecular Weight | 362.14 |
| CAS Registry Number | 73840-18-3 |
| SMILES | C3=C(N1C(=O)N(C1=O)C2=CC=C(Br)C=C2)C=CC(=C3)[N+]([O-])=O |
| InChI | 1S/C14H8BrN3O4/c15-9-1-3-10(4-2-9)16-13(19)17(14(16)20)11-5-7-12(8-6-11)18(21)22/h1-8H |
| InChIKey | PIRUCMJNESTBDI-UHFFFAOYSA-N |
| Density | 1.788g/cm3 (Cal.) |
|---|---|
| Boiling point | 502°C at 760 mmHg (Cal.) |
| Flash point | 257.401°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Bromophenyl)-3-(4-Nitrophenyl)-1,3-Diazetidine-2,4-Dione |