|
CAS#: 73855-52-4 Product: 3-Chloro-2,6-Dihydroxy-4-Methylbenzoic Acid No suppilers available for the product. |
| Name | 3-Chloro-2,6-Dihydroxy-4-Methylbenzoic Acid |
|---|---|
| Synonyms | 3-Chloro-2,6-Dihydroxy-4-Methyl-Benzoic Acid; 3-Chloro-4-Methyl-2,6-Dihydroxybenzoic Acid; Benzoic Acid, 3-Chloro-2,6-Dihydroxy-4-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7ClO4 |
| Molecular Weight | 202.59 |
| CAS Registry Number | 73855-52-4 |
| SMILES | C1=C(C(=C(O)C(=C1O)C(=O)O)Cl)C |
| InChI | 1S/C8H7ClO4/c1-3-2-4(10)5(8(12)13)7(11)6(3)9/h2,10-11H,1H3,(H,12,13) |
| InChIKey | HDYBXCNOZUWZRU-UHFFFAOYSA-N |
| Density | 1.595g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.829°C at 760 mmHg (Cal.) |
| Flash point | 172.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-2,6-Dihydroxy-4-Methylbenzoic Acid |