|
CAS#: 73855-95-5 Product: 3-Ethyl-3-(Phenylmethyl)Azetidin-2-One No suppilers available for the product. |
| Name | 3-Ethyl-3-(Phenylmethyl)Azetidin-2-One |
|---|---|
| Synonyms | 3-Ethyl-3-(Phenylmethyl)-2-Azetidinone; 3-(Benzyl)-3-Ethyl-Azetidin-2-One; 2-Azetidinone, 3-Benzyl-3-Ethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 |
| CAS Registry Number | 73855-95-5 |
| SMILES | C2=C(CC1(C(=O)NC1)CC)C=CC=C2 |
| InChI | 1S/C12H15NO/c1-2-12(9-13-11(12)14)8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,13,14) |
| InChIKey | UWPKFNZGDCDBHX-UHFFFAOYSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.521°C at 760 mmHg (Cal.) |
| Flash point | 210.097°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-3-(Phenylmethyl)Azetidin-2-One |