|
CAS#: 73908-79-9 Product: 8-[2-(1,3-Benzodioxol-5-Yl)Ethenyl]-1,3-Dimethyl-7H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 8-[2-(1,3-Benzodioxol-5-Yl)Ethenyl]-1,3-Dimethyl-7H-Purine-2,6-Dione |
|---|---|
| Synonyms | 8-[(E)-2-(1,3-Benzodioxol-5-Yl)Ethenyl]-1,3-Dimethyl-7H-Purine-2,6-Dione; 8-[2-(1,3-Benzodioxol-5-Yl)Vinyl]-1,3-Dimethyl-7H-Purine-2,6-Dione; 8-[(E)-2-(1,3-Benzodioxol-5-Yl)Vinyl]-1,3-Dimethyl-7H-Purine-2,6-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 |
| CAS Registry Number | 73908-79-9 |
| SMILES | C2=C1OCOC1=CC=C2/C=C/C3=NC4=C([NH]3)C(N(C(N4C)=O)C)=O |
| InChI | 1S/C16H14N4O4/c1-19-14-13(15(21)20(2)16(19)22)17-12(18-14)6-4-9-3-5-10-11(7-9)24-8-23-10/h3-7H,8H2,1-2H3,(H,17,18)/b6-4+ |
| InChIKey | AVFMEQZKKIUQAF-GQCTYLIASA-N |
| Density | 1.502g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.858°C at 760 mmHg (Cal.) |
| Flash point | 317.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-[2-(1,3-Benzodioxol-5-Yl)Ethenyl]-1,3-Dimethyl-7H-Purine-2,6-Dione |