|
CAS#: 7391-63-1 Product: 5-Sec-Butyl-1,3-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione No suppilers available for the product. |
| Name | 5-Sec-Butyl-1,3-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |
|---|---|
| Synonyms | 1,3-Dimethyl-5-Sec-Butyl-Hexahydropyrimidine-2,4,6-Trione; 1,3-Dimethyl-5-Sec-Butylhexahydropyrimidine-2,4,6-Trione; 1,3-Dimethyl-5-Sec-Butyl-Barbituric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 |
| CAS Registry Number | 7391-63-1 |
| SMILES | C(C(C1C(N(C(N(C1=O)C)=O)C)=O)C)C |
| InChI | 1S/C10H16N2O3/c1-5-6(2)7-8(13)11(3)10(15)12(4)9(7)14/h6-7H,5H2,1-4H3 |
| InChIKey | LXEIFFQUCUFHQP-UHFFFAOYSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.838°C at 760 mmHg (Cal.) |
| Flash point | 108.807°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Sec-Butyl-1,3-Dimethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |