|
CAS#: 7391-72-2 Product: 2,3'-Dinitrobiphenyl No suppilers available for the product. |
| Name | 2,3'-Dinitrobiphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,3'-Dinitro-; 2,3'-Dinitro-1,1'-Biphenyl; Zinc02556288 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.21 |
| CAS Registry Number | 7391-72-2 |
| SMILES | C1=CC=CC(=C1C2=CC=CC(=C2)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C12H8N2O4/c15-13(16)10-5-3-4-9(8-10)11-6-1-2-7-12(11)14(17)18/h1-8H |
| InChIKey | FMHCZXFBIPODBJ-UHFFFAOYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.634°C at 760 mmHg (Cal.) |
| Flash point | 197.601°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3'-Dinitrobiphenyl |