|
CAS#: 7393-13-7 Product: N-(Dimethylamino-Phenoxy-Phosphoryl)-N-Methyl-Methanamine No suppilers available for the product. |
| Name | N-(Dimethylamino-Phenoxy-Phosphoryl)-N-Methyl-Methanamine |
|---|---|
| Synonyms | N-(Dimethylamino-(Phenoxy)Phosphoryl)-N-Methyl-Methanamine; (Dimethylamino-(Phenoxy)Phosphoryl)-Dimethyl-Amine; Nsc315171 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17N2O2P |
| Molecular Weight | 228.23 |
| CAS Registry Number | 7393-13-7 |
| SMILES | C1=CC=CC=C1O[P](=O)(N(C)C)N(C)C |
| InChI | 1S/C10H17N2O2P/c1-11(2)15(13,12(3)4)14-10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | VEULIWWJVLYNEX-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.162°C at 760 mmHg (Cal.) |
| Flash point | 126.867°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Dimethylamino-Phenoxy-Phosphoryl)-N-Methyl-Methanamine |