|
CAS#: 73941-34-1 Product: 4-Methyl-1-(5-Nitro-1H-Imidazol-4-Yl)Piperidine No suppilers available for the product. |
| Name | 4-Methyl-1-(5-Nitro-1H-Imidazol-4-Yl)Piperidine |
|---|---|
| Synonyms | Imidazole, 5-Nitro-4-(4-Methylpiperidino)-; Piperidine, 4-Methyl-1-(5-Nitro-1H-Imidazol-4-Yl)-; 4-Pipecoline, 1-((4-Nitroimidazol-5-Yl)Carbonyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 |
| CAS Registry Number | 73941-34-1 |
| SMILES | C1=NC(=C([N+]([O-])=O)[NH]1)N2CCC(CC2)C |
| InChI | 1S/C9H14N4O2/c1-7-2-4-12(5-3-7)8-9(13(14)15)11-6-10-8/h6-7H,2-5H2,1H3,(H,10,11) |
| InChIKey | XOKFAXKYFQPESM-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.277°C at 760 mmHg (Cal.) |
| Flash point | 222.491°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-1-(5-Nitro-1H-Imidazol-4-Yl)Piperidine |