|
CAS#: 7402-06-4 Product: 3,4-Diphenylcyclopent-3-En-1-One No suppilers available for the product. |
| Name | 3,4-Diphenylcyclopent-3-En-1-One |
|---|---|
| Synonyms | 3,4-Di(Phenyl)-1-Cyclopent-3-Enone; Nsc54811 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 |
| CAS Registry Number | 7402-06-4 |
| SMILES | C1=CC=CC=C1C2=C(CC(=O)C2)C3=CC=CC=C3 |
| InChI | 1S/C17H14O/c18-15-11-16(13-7-3-1-4-8-13)17(12-15)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | MQUNFFXYECDJOU-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.457°C at 760 mmHg (Cal.) |
| Flash point | 171.482°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Diphenylcyclopent-3-En-1-One |