Online Database of Chemicals from Around the World
|
CAS#: 74037-43-7 Product: 3-(2-Chlorophenyl)Diazenylpyridine-2,6-Diamine No suppilers available for the product. |
| Name | 3-(2-Chlorophenyl)Diazenylpyridine-2,6-Diamine |
|---|---|
| Synonyms | 3-(2-Chlorophenyl)Azopyridine-2,6-Diamine; [6-Amino-3-(2-Chlorophenyl)Azo-2-Pyridyl]Amine; 2,6-Pyridinediamine, 3-[(2-Chlorophenyl)Azo]- |
| Molecular Structure |  |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.69 |
| CAS Registry Number | 74037-43-7 |
| SMILES | C2=C(N=NC1=CC=CC=C1Cl)C(=NC(=C2)N)N |
| InChI | 1S/C11H10ClN5/c12-7-3-1-2-4-8(7)16-17-9-5-6-10(13)15-11(9)14/h1-6H,(H4,13,14,15) |
| InChIKey | FMSVBEHFAIKRNX-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.901°C at 760 mmHg (Cal.) |
| Flash point | 245.245°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Chlorophenyl)Diazenylpyridine-2,6-Diamine |