|
CAS#: 74038-27-0 Product: 1-Dibutylphosphoryloxy-3-Nitrobenzene No suppilers available for the product. |
| Name | 1-Dibutylphosphoryloxy-3-Nitrobenzene |
|---|---|
| Synonyms | 1-Dibutylphosphoryloxy-3-Nitro-Benzene; 4-06-00-01277 (Beilstein Handbook Reference); Brn 3384389 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22NO4P |
| Molecular Weight | 299.31 |
| CAS Registry Number | 74038-27-0 |
| SMILES | C1=C([N+]([O-])=O)C=CC=C1O[P](=O)(CCCC)CCCC |
| InChI | 1S/C14H22NO4P/c1-3-5-10-20(18,11-6-4-2)19-14-9-7-8-13(12-14)15(16)17/h7-9,12H,3-6,10-11H2,1-2H3 |
| InChIKey | LGUBTNHKGWEBEA-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.393°C at 760 mmHg (Cal.) |
| Flash point | 192.322°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Dibutylphosphoryloxy-3-Nitrobenzene |