|
CAS#: 74038-47-4 Product: 1-Diethoxyphosphoryl-2-Methylpropan-1-Ol No suppilers available for the product. |
| Name | 1-Diethoxyphosphoryl-2-Methylpropan-1-Ol |
|---|---|
| Synonyms | 1-Diethoxyphosphoryl-2-Methyl-Propan-1-Ol; (1-Hydroxy-2-Methylpropyl)Phosphonic Acid Diethyl Ester; Diethyl-.Alpha.-Hydroxyisobutylphosphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19O4P |
| Molecular Weight | 210.21 |
| CAS Registry Number | 74038-47-4 |
| SMILES | C(O[P](C(C(C)C)O)(OCC)=O)C |
| InChI | 1S/C8H19O4P/c1-5-11-13(10,12-6-2)8(9)7(3)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | MHCIATHWPPJEEC-UHFFFAOYSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.307°C at 760 mmHg (Cal.) |
| Flash point | 122.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Diethoxyphosphoryl-2-Methylpropan-1-Ol |