|
CAS#: 74039-46-6 Product: 1,2,3,4,5-Pentachloro-6-(Trichloromethylsulfinyl)Benzene No suppilers available for the product. |
| Name | 1,2,3,4,5-Pentachloro-6-(Trichloromethylsulfinyl)Benzene |
|---|---|
| Synonyms | Sulfoxide, Pentachlorophenyl Trichloromethyl |
| Molecular Structure | ![]() |
| Molecular Formula | C7Cl8OS |
| Molecular Weight | 415.76 |
| CAS Registry Number | 74039-46-6 |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)[S](=O)C(Cl)(Cl)Cl |
| InChI | 1S/C7Cl8OS/c8-1-2(9)4(11)6(5(12)3(1)10)17(16)7(13,14)15 |
| InChIKey | RFFMSSMUKAOONC-UHFFFAOYSA-N |
| Density | 2.004g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.638°C at 760 mmHg (Cal.) |
| Flash point | 228.152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentachloro-6-(Trichloromethylsulfinyl)Benzene |