|
CAS#: 74039-62-6 Product: 1,3-Dimethyl-8-Prop-2-Enyl-7H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 1,3-Dimethyl-8-Prop-2-Enyl-7H-Purine-2,6-Dione |
|---|---|
| Synonyms | 8-Allyl-1,3-Dimethyl-7H-Purine-2,6-Dione; 8-Allyl-1,3-Dimethyl-7H-Purine-2,6-Quinone; 1H-Purine-2,6-Dione, 3,7-Dihydro-1,3-Dimethyl-8-(2-Propenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 |
| CAS Registry Number | 74039-62-6 |
| SMILES | C(C2=NC1=C(C(N(C)C(N1C)=O)=O)[NH]2)C=C |
| InChI | 1S/C10H12N4O2/c1-4-5-6-11-7-8(12-6)13(2)10(16)14(3)9(7)15/h4H,1,5H2,2-3H3,(H,11,12) |
| InChIKey | SUFDPQNULQXJTM-UHFFFAOYSA-N |
| Density | 1.316g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.587°C at 760 mmHg (Cal.) |
| Flash point | 235.984°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-8-Prop-2-Enyl-7H-Purine-2,6-Dione |