|
CAS#: 7408-18-6 Product: 2,2'-Oxydisuccinic Acid No suppilers available for the product. |
| Name | 2,2'-Oxydisuccinic Acid |
|---|---|
| Synonyms | 2-(1-Carboxy-3-Hydroxy-3-Oxo-Propoxy)Butanedioic Acid; 2-(1-Carboxy-3-Hydroxy-3-Oxopropoxy)Butanedioic Acid; 2-(1-Carboxy-3-Hydroxy-3-Keto-Propoxy)Succinic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10O9 |
| Molecular Weight | 250.16 |
| CAS Registry Number | 7408-18-6 |
| EINECS | 231-015-2 |
| SMILES | C(C(OC(C(=O)O)CC(=O)O)C(=O)O)C(=O)O |
| InChI | 1S/C8H10O9/c9-5(10)1-3(7(13)14)17-4(8(15)16)2-6(11)12/h3-4H,1-2H2,(H,9,10)(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | CFPOJWPDQWJEMO-UHFFFAOYSA-N |
| Density | 1.711g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.068°C at 760 mmHg (Cal.) |
| Flash point | 210.934°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Oxydisuccinic Acid |