|
CAS#: 74131-21-8 Product: Propan-2-Yl 5-Ethoxy-2-Sulfamoylbenzoate No suppilers available for the product. |
| Name | Propan-2-Yl 5-Ethoxy-2-Sulfamoylbenzoate |
|---|---|
| Synonyms | Isopropyl 5-Ethoxy-2-Sulfamoyl-Benzoate; 5-Ethoxy-2-Sulfamoylbenzoic Acid Isopropyl Ester; 5-Ethoxy-2-Sulfamoyl-Benzoic Acid Isopropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.33 |
| CAS Registry Number | 74131-21-8 |
| SMILES | C1=C(C(=CC(=C1)OCC)C(=O)OC(C)C)[S](=O)(=O)N |
| InChI | 1S/C12H17NO5S/c1-4-17-9-5-6-11(19(13,15)16)10(7-9)12(14)18-8(2)3/h5-8H,4H2,1-3H3,(H2,13,15,16) |
| InChIKey | CBSWZBYUZHMHTB-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.723°C at 760 mmHg (Cal.) |
| Flash point | 229.413°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propan-2-Yl 5-Ethoxy-2-Sulfamoylbenzoate |