Online Database of Chemicals from Around the World
|
CAS#: 74143-31-0 Product: Chloro-[1-[4-(Chloromethyl)Phenyl]Ethyl]-Dimethylsilane No suppilers available for the product. |
| Name | Chloro-[1-[4-(Chloromethyl)Phenyl]Ethyl]-Dimethylsilane |
|---|---|
| Synonyms | Chloro-[1-[4-(Chloromethyl)Phenyl]Ethyl]-Dimethyl-Silane; Chloro(1-(4-(Chloromethyl)Phenyl)Ethyl)Dimethylsilane |
| Molecular Structure | ![CAS#: 74143-31-0, Chloro-[1-[4-(Chloromethyl)Phenyl]Ethyl]-Dimethylsilane](/moreStructures/74143-31-0.gif) |
| Molecular Formula | C11H16Cl2Si |
| Molecular Weight | 247.24 |
| CAS Registry Number | 74143-31-0 |
| EINECS | 277-732-4 |
| SMILES | C1=C(C([Si](Cl)(C)C)C)C=CC(=C1)CCl |
| InChI | 1S/C11H16Cl2Si/c1-9(14(2,3)13)11-6-4-10(8-12)5-7-11/h4-7,9H,8H2,1-3H3 |
| InChIKey | WSAOHLZSKAXQJI-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.054°C at 760 mmHg (Cal.) |
| Flash point | 136.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloro-[1-[4-(Chloromethyl)Phenyl]Ethyl]-Dimethylsilane |