|
CAS#: 74148-46-2 Product: Mitomycin G No suppilers available for the product. |
| Name | Mitomycin G |
|---|---|
| Synonyms | Azirino(2',3':3,4)Pyrrolo(1,2-A)Indole-4,7-Dione, 1,1A,2,8,8A,8B-Hexahydro-6-Amino-8A-Methoxy-1,5-Dimethyl-8-Methylene-, (1As-(1A-Alpha,8A-Alpha,8B-Alpha))-; Brn 5984149 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 |
| CAS Registry Number | 74148-46-2 |
| SMILES | [C@]23(C(C1=C(C(C(=C(C1=O)N)C)=O)N2[C@@H]4[C@H](C3)N4C)=C)OC |
| InChI | 1S/C15H17N3O3/c1-6-10(16)13(20)9-7(2)15(21-4)5-8-14(17(8)3)18(15)11(9)12(6)19/h8,14H,2,5,16H2,1,3-4H3/t8-,14+,15-,17?/m0/s1 |
| InChIKey | NBOLRCKHHWQJJM-MNXXXQGXSA-N |
| Density | 1.433g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.413°C at 760 mmHg (Cal.) |
| Flash point | 224.387°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mitomycin G |