Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Acetyl-4-Dimethylaminosalicylic Acid |
|---|---|
| Synonyms | 2-Acetoxy-4-Dimethylamino-Benzoic Acid; 2-Acetoxy-4-Dimethylaminobenzoic Acid; 2-Acetyloxy-4-Dimethylamino-Benzoic Acid |
| Molecular Structure |  |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 74152-38-8 |
| SMILES | C1=CC(=C(OC(C)=O)C=C1N(C)C)C(O)=O |
| InChI | 1S/C11H13NO4/c1-7(13)16-10-6-8(12(2)3)4-5-9(10)11(14)15/h4-6H,1-3H3,(H,14,15) |
| InChIKey | VSTASNVGRSVNOD-UHFFFAOYSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.105°C at 760 mmHg (Cal.) |
| Flash point | 193.963°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetyl-4-Dimethylaminosalicylic Acid |