|
CAS#: 74257-27-5 Product: (2S)-2-Amino-4-Nitramidobutanoic Acid No suppilers available for the product. |
| Name | (2S)-2-Amino-4-Nitramidobutanoic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-4-Nitramido-Butanoic Acid; (2S)-2-Amino-4-Nitramido-Butyric Acid; A-N-Gaba |
| Molecular Structure | ![]() |
| Molecular Formula | C4H9N3O4 |
| Molecular Weight | 163.13 |
| CAS Registry Number | 74257-27-5 |
| SMILES | [C@@H](N)(C(=O)O)CCN[N+]([O-])=O |
| InChI | 1S/C4H9N3O4/c5-3(4(8)9)1-2-6-7(10)11/h3,6H,1-2,5H2,(H,8,9)/t3-/m0/s1 |
| InChIKey | ZDBGMQCCHXQCND-VKHMYHEASA-N |
| Density | 1.421g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.742°C at 760 mmHg (Cal.) |
| Flash point | 189.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-4-Nitramidobutanoic Acid |