|
CAS#: 743-45-3 Product: 5-Allyl-1,3-Diphenyl-2,4,6(1H,3H,5H)-Pyrimidinetrione No suppilers available for the product. |
| Name | 5-Allyl-1,3-Diphenyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |
|---|---|
| Synonyms | 5-Allyl-1,3-Di(Phenyl)Hexahydropyrimidine-2,4,6-Trione; 5-Allyl-1,3-Di(Phenyl)Barbituric Acid; Brn 0558728 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 |
| CAS Registry Number | 743-45-3 |
| SMILES | C3=C(N2C(N(C1=CC=CC=C1)C(C(C2=O)CC=C)=O)=O)C=CC=C3 |
| InChI | 1S/C19H16N2O3/c1-2-9-16-17(22)20(14-10-5-3-6-11-14)19(24)21(18(16)23)15-12-7-4-8-13-15/h2-8,10-13,16H,1,9H2 |
| InChIKey | CSCJXJYSSKSVQF-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.888°C at 760 mmHg (Cal.) |
| Flash point | 191.083°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Allyl-1,3-Diphenyl-2,4,6(1H,3H,5H)-Pyrimidinetrione |