|
CAS#: 74332-79-9 Product: 1-(2-Methyl-1-Phenylpropyl)Pyrrolidine Hydrochloride No suppilers available for the product. |
| Name | 1-(2-Methyl-1-Phenylpropyl)Pyrrolidine Hydrochloride |
|---|---|
| Synonyms | 1-(2-Methyl-1-Phenyl-Propyl)Pyrrolidine Hydrochloride; H 566; Pyrrolidine, 1-(Alpha-Isopropylbenzyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 |
| CAS Registry Number | 74332-79-9 |
| SMILES | [H+].C2=C(C(N1CCCC1)C(C)C)C=CC=C2.[Cl-] |
| InChI | 1S/C14H21N.ClH/c1-12(2)14(15-10-6-7-11-15)13-8-4-3-5-9-13;/h3-5,8-9,12,14H,6-7,10-11H2,1-2H3;1H |
| InChIKey | FYFVWYAYFDVXCQ-UHFFFAOYSA-N |
| Boiling point | 265.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 104.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methyl-1-Phenylpropyl)Pyrrolidine Hydrochloride |