|
CAS#: 743388-88-7 Product: 4-{[(6-Hydroxy-7-isopropyl-4,5-dimethyl-1,3-benzothiazol-2-yl)amino]methyl}benzenesulfonamide No suppilers available for the product. |
| Name | 4-{[(6-Hydroxy-7-isopropyl-4,5-dimethyl-1,3-benzothiazol-2-yl)amino]methyl}benzenesulfonamide |
|---|---|
| Synonyms | BENZENESU |
| Molecular Structure | ![]() |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.53 |
| CAS Registry Number | 743388-88-7 |
| SMILES | Cc1c(c(c(c2c1nc(s2)NCc3ccc(cc3)S(=O)(=O)N)C(C)C)O)C |
| InChI | 1S/C19H23N3O3S2/c1-10(2)15-17(23)12(4)11(3)16-18(15)26-19(22-16)21-9-13-5-7-14(8-6-13)27(20,24)25/h5-8,10,23H,9H2,1-4H3,(H,21,22)(H2,20,24,25) |
| InChIKey | BRXJNPQSHKIISH-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 625.858°C at 760 mmHg (Cal.) |
| Flash point | 332.307°C (Cal.) |
| Refractive index | 1.667 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{[(6-Hydroxy-7-isopropyl-4,5-dimethyl-1,3-benzothiazol-2-yl)amino]methyl}benzenesulfonamide |