|
CAS#: 74339-98-3 Product: trans-Benz(a,e)fluoranthene-12,13-dihydrodiol No suppilers available for the product. |
| Name | trans-Benz(a,e)fluoranthene-12,13-dihydrodiol |
|---|---|
| Synonyms | Dibenz(A,E)Aceanthrylene-1,2-Diol, 1,2-Dihydro-, Trans-; Trans-1,2-Dihydrodibenz(A,E)Aceanthrylene-1,2-Diol; Trans-12,13-Dihydro-12,13-Dihydroxydibenzo(A,E)Fluoranthene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H16O2 |
| Molecular Weight | 336.39 |
| CAS Registry Number | 74339-98-3 |
| SMILES | [C@@H]1(C4=C(C=C[C@@H]1O)C5=C3C(=CC2=CC=CC=C2C3=C4)C6=CC=CC=C56)O |
| InChI | 1S/C24H16O2/c25-21-10-9-17-20(24(21)26)12-19-14-6-2-1-5-13(14)11-18-15-7-3-4-8-16(15)22(17)23(18)19/h1-12,21,24-26H/t21-,24-/m0/s1 |
| InChIKey | FWXWCFAETRJJCO-URXFXBBRSA-N |
| Density | 1.461g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.557°C at 760 mmHg (Cal.) |
| Flash point | 298.992°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-Benz(a,e)fluoranthene-12,13-dihydrodiol |