|
CAS#: 74388-74-2 Product: 2-(2,4-Dichlorophenoxy)Ethyl Prop-2-Enoate No suppilers available for the product. |
| Name | 2-(2,4-Dichlorophenoxy)Ethyl Prop-2-Enoate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 2-(2,4-Dichlorophenoxy)Ethyl Ester; Acrylic Acid 2-(2,4-Dichlorophenoxy)Ethyl Ester; Nsc19673 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10Cl2O3 |
| Molecular Weight | 261.10 |
| CAS Registry Number | 74388-74-2 |
| SMILES | C1=CC(=CC(=C1OCCOC(C=C)=O)Cl)Cl |
| InChI | 1S/C11H10Cl2O3/c1-2-11(14)16-6-5-15-10-4-3-8(12)7-9(10)13/h2-4,7H,1,5-6H2 |
| InChIKey | PCNUEDFWPSMJOF-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.735°C at 760 mmHg (Cal.) |
| Flash point | 147.311°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dichlorophenoxy)Ethyl Prop-2-Enoate |