|
CAS#: 7439-10-3 Product: Tert-Butyl(4-Methylphenyl) Sulfide No suppilers available for the product. |
| Name | Tert-Butyl(4-Methylphenyl) Sulfide |
|---|---|
| Synonyms | 1-Tert-Butylsulfanyl-4-Methyl-Benzene; 1-(Tert-Butylthio)-4-Methylbenzene; 1-(Tert-Butylthio)-4-Methyl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16S |
| Molecular Weight | 180.31 |
| CAS Registry Number | 7439-10-3 |
| SMILES | C1=C(SC(C)(C)C)C=CC(=C1)C |
| InChI | 1S/C11H16S/c1-9-5-7-10(8-6-9)12-11(2,3)4/h5-8H,1-4H3 |
| InChIKey | GPZPDHTYJTVKEO-UHFFFAOYSA-N |
| Density | 0.968g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.504°C at 760 mmHg (Cal.) |
| Flash point | 101.073°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl(4-Methylphenyl) Sulfide |