Online Database of Chemicals from Around the World
|
CAS#: 74417-16-6 Product: 3-(3,4-Dichlorophenoxy)-5,6-Di(Phenyl)-1,2,4-Triazine No suppilers available for the product. |
| Name | 3-(3,4-Dichlorophenoxy)-5,6-Di(Phenyl)-1,2,4-Triazine |
|---|---|
| Synonyms | 1,2,4-Triazine, 3-(3,4-Dichlorophenoxy)-5,6-Diphenyl-; 3-(3,4-Dichlorophenoxy)-5,6-Diphenyl-As-Triazine; As-Triazine, 3-(3,4-Dichlorophenoxy)-5,6-Diphenyl- |
| Molecular Structure |  |
| Molecular Formula | C21H13Cl2N3O |
| Molecular Weight | 394.26 |
| CAS Registry Number | 74417-16-6 |
| SMILES | C1=CC=CC=C1C2=C(N=C(N=N2)OC3=CC=C(C(=C3)Cl)Cl)C4=CC=CC=C4 |
| InChI | 1S/C21H13Cl2N3O/c22-17-12-11-16(13-18(17)23)27-21-24-19(14-7-3-1-4-8-14)20(25-26-21)15-9-5-2-6-10-15/h1-13H |
| InChIKey | NKXSDKJIFHLVQO-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.479°C at 760 mmHg (Cal.) |
| Flash point | 289.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,4-Dichlorophenoxy)-5,6-Di(Phenyl)-1,2,4-Triazine |