|
CAS#: 74440-45-2 Product: 1,1,1,3,3,3-Hexadeuterio-2-Methylpropane No suppilers available for the product. |
| Name | 1,1,1,3,3,3-Hexadeuterio-2-Methylpropane |
|---|---|
| Synonyms | 1,1,1,3,3,3-Hexadeuterio-2-Methyl-Propane; Propane-1,1,1,3,3,3-D6, 2-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4D6 |
| Molecular Weight | 64.16 |
| CAS Registry Number | 74440-45-2 |
| SMILES | C([2H])([2H])([2H])C(C([2H])([2H])[2H])C |
| InChI | 1S/C4H10/c1-4(2)3/h4H,1-3H3/i1D3,2D3 |
| InChIKey | NNPPMTNAJDCUHE-WFGJKAKNSA-N |
| Density | 0.676g/cm3 (Cal.) |
|---|---|
| Boiling point | -10.49°C at 760 mmHg (Cal.) |
| Flash point | -71.515°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,3,3-Hexadeuterio-2-Methylpropane |