|
CAS#: 7449-27-6 Product: N-Ethyl-2,4,6-Trinitroaniline No suppilers available for the product. |
| Name | N-Ethyl-2,4,6-Trinitroaniline |
|---|---|
| Synonyms | N-Ethyl-2,4,6-Trinitro-Aniline; Ethyl-(2,4,6-Trinitrophenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N4O6 |
| Molecular Weight | 256.17 |
| CAS Registry Number | 7449-27-6 |
| EINECS | 231-216-5 |
| SMILES | C1=C(C(=C(C=C1[N+]([O-])=O)[N+]([O-])=O)NCC)[N+]([O-])=O |
| InChI | 1S/C8H8N4O6/c1-2-9-8-6(11(15)16)3-5(10(13)14)4-7(8)12(17)18/h3-4,9H,2H2,1H3 |
| InChIKey | JRLUWLIIVKSPPT-UHFFFAOYSA-N |
| Density | 1.592g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.293°C at 760 mmHg (Cal.) |
| Flash point | 194.681°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-2,4,6-Trinitroaniline |