|
CAS#: 7459-97-4 Product: Atropine Nitrate No suppilers available for the product. |
| Name | Atropine Nitrate |
|---|---|
| Synonyms | (8-Methyl-8-Azabicyclo[3.2.1]Octan-3-Yl) 3-Hydroxy-2-Phenyl-Propanoate; Nitric Acid; 3-Hydroxy-2-Phenylpropanoic Acid (8-Methyl-8-Azabicyclo[3.2.1]Octan-3-Yl) Ester; Nitric Acid; 3-Hydroxy-2-Phenyl-Propionic Acid (8-Methyl-8-Azabicyclo[3.2.1]Octan-3-Yl) Ester; Nitric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 |
| CAS Registry Number | 7459-97-4 |
| EINECS | 231-242-7 |
| SMILES | C2(OC(=O)C(C1=CC=CC=C1)CO)CC3N(C(C2)CC3)C.O=[N+]([O-])O |
| InChI | 1S/C17H23NO3.HNO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12;2-1(3)4/h2-6,13-16,19H,7-11H2,1H3;(H,2,3,4) |
| InChIKey | MJYHSOCPRKVNKH-UHFFFAOYSA-N |
| Boiling point | 429.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 213.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Atropine Nitrate |