|
CAS#: 74672-14-3 Product: 1-(4-Methyl-4-penten-2-yl)-4-(trifluoromethyl)benzene No suppilers available for the product. |
| Name | 1-(4-Methyl-4-penten-2-yl)-4-(trifluoromethyl)benzene |
|---|---|
| Synonyms | 1-(1,3-Dimethyl-3-butenyl)-4-(trifluoromethyl)benzene # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15F3 |
| Molecular Weight | 228.25 |
| CAS Registry Number | 74672-14-3 |
| SMILES | FC(F)(F)c1ccc(cc1)C(CC(=C)\C)C |
| InChI | 1S/C13H15F3/c1-9(2)8-10(3)11-4-6-12(7-5-11)13(14,15)16/h4-7,10H,1,8H2,2-3H3 |
| InChIKey | LCDFIJCBLKTDIJ-UHFFFAOYSA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.981°C at 760 mmHg (Cal.) |
| Flash point | 81.227°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methyl-4-penten-2-yl)-4-(trifluoromethyl)benzene |