|
CAS#: 7470-31-7 Product: 3-(2,2-Diphenylethenyl)-5-Phenyl-2H-Pyrazole No suppilers available for the product. |
| Name | 3-(2,2-Diphenylethenyl)-5-Phenyl-2H-Pyrazole |
|---|---|
| Synonyms | 3-[2,2-Di(Phenyl)Vinyl]-5-Phenyl-2H-Pyrazole; Nsc402499 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H18N2 |
| Molecular Weight | 322.41 |
| CAS Registry Number | 7470-31-7 |
| SMILES | C1=C([NH]N=C1C2=CC=CC=C2)C=C(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C23H18N2/c1-4-10-18(11-5-1)22(19-12-6-2-7-13-19)16-21-17-23(25-24-21)20-14-8-3-9-15-20/h1-17H,(H,24,25) |
| InChIKey | RVKYDEQPDQCXLS-UHFFFAOYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.337°C at 760 mmHg (Cal.) |
| Flash point | 230.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2,2-Diphenylethenyl)-5-Phenyl-2H-Pyrazole |