|
CAS#: 74810-47-2 Product: 1,3-Bis(trimethylsilyl)dihydro-2,4(1H,3H)-pyrimidinedione No suppilers available for the product. |
| Name | 1,3-Bis(trimethylsilyl)dihydro-2,4(1H,3H)-pyrimidinedione |
|---|---|
| Synonyms | 1,3-Bis(trimethylsilyl)dihydro-2,4(1H,3H)-pyrimidinedione # |
| Molecular Structure | ![]() |
| Molecular Formula | C10H22N2O2Si2 |
| Molecular Weight | 258.46 |
| CAS Registry Number | 74810-47-2 |
| SMILES | O=C1N(CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C |
| InChI | 1S/C10H22N2O2Si2/c1-15(2,3)11-8-7-9(13)12(10(11)14)16(4,5)6/h7-8H2,1-6H3 |
| InChIKey | CWBONJLCWNOPPR-UHFFFAOYSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.049°C at 760 mmHg (Cal.) |
| Flash point | 119.541°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(trimethylsilyl)dihydro-2,4(1H,3H)-pyrimidinedione |