|
CAS#: 74902-59-3 Product: 1-(4-Amino-3-Nitrophenyl)-2-Bromoethanone No suppilers available for the product. |
| Name | 1-(4-Amino-3-Nitrophenyl)-2-Bromoethanone |
|---|---|
| Synonyms | 1-(4-Amino-3-Nitro-Phenyl)-2-Bromo-Ethanone; Aba-Nap; Ethanone, 1-(4-Amino-3-Nitrophenyl)-2-Bromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7BrN2O3 |
| Molecular Weight | 259.06 |
| CAS Registry Number | 74902-59-3 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1C(=O)CBr)N |
| InChI | 1S/C8H7BrN2O3/c9-4-8(12)5-1-2-6(10)7(3-5)11(13)14/h1-3H,4,10H2 |
| InChIKey | LCFRGYUASANOFK-UHFFFAOYSA-N |
| Density | 1.747g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.005°C at 760 mmHg (Cal.) |
| Flash point | 185.435°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Amino-3-Nitrophenyl)-2-Bromoethanone |