|
CAS#: 7495-46-7 Product: 2,2',3,3'-Tetramethylbiphenyl No suppilers available for the product. |
| Name | 2,2',3,3'-Tetramethylbiphenyl |
|---|---|
| Synonyms | 1-(2,3-Dimethylphenyl)-2,3-Dimethyl-Benzene; 1,1'-Biphenyl, 2,2',3,3'-Tetramethyl-; Nsc407714 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 7495-46-7 |
| SMILES | C1=CC=C(C)C(=C1C2=C(C)C(=CC=C2)C)C |
| InChI | 1S/C16H18/c1-11-7-5-9-15(13(11)3)16-10-6-8-12(2)14(16)4/h5-10H,1-4H3 |
| InChIKey | NGDMCVXWKKYGRQ-UHFFFAOYSA-N |
| Density | 0.957g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.333°C at 760 mmHg (Cal.) |
| Flash point | 131.333°C (Cal.) |
| (1) | Müller Christian. Atropisomeric phosphinines: design and synthesis, Dalton Transactions, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2',3,3'-Tetramethylbiphenyl |