|
CAS#: 7497-11-2 Product: Carbonic Acid Bis(2,4,6-Trichlorophenyl) Ester No suppilers available for the product. |
| Name | Carbonic Acid Bis(2,4,6-Trichlorophenyl) Ester |
|---|---|
| Synonyms | Carbonic Acid Bis(2,4,6-Trichlorophenyl) Ester; Nsc405025 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H4Cl6O3 |
| Molecular Weight | 420.89 |
| CAS Registry Number | 7497-11-2 |
| EINECS | 231-349-9 |
| SMILES | C1=C(C(=C(C=C1Cl)Cl)OC(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl |
| InChI | 1S/C13H4Cl6O3/c14-5-1-7(16)11(8(17)2-5)21-13(20)22-12-9(18)3-6(15)4-10(12)19/h1-4H |
| InChIKey | JOJNCSKBTSMKKW-UHFFFAOYSA-N |
| Density | 1.679g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.323°C at 760 mmHg (Cal.) |
| Flash point | 184.48°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carbonic Acid Bis(2,4,6-Trichlorophenyl) Ester |