|
CAS#: 7497-72-5 Product: (4-Phenyl-1-Cyclopenta-1,3-Dienyl)Benzene compound with1,3,5-Trinitrobenzene No suppilers available for the product. |
| Name | (4-Phenyl-1-Cyclopenta-1,3-Dienyl)Benzene compound with1,3,5-Trinitrobenzene |
|---|---|
| Synonyms | Nsc406811 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H17N3O6 |
| Molecular Weight | 431.40 |
| CAS Registry Number | 7497-72-5 |
| SMILES | C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.C4=C(C2=CC=C(C2)C3=CC=CC=C3)C=CC=C4 |
| InChI | 1S/C17H14.C6H3N3O6/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-12H,13H2;1-3H |
| InChIKey | IYHLNQSASNUORW-UHFFFAOYSA-N |
| Boiling point | 350.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 177.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Phenyl-1-Cyclopenta-1,3-Dienyl)Benzene compound with1,3,5-Trinitrobenzene |