|
CAS#: 74980-06-6 Product: (2S)-2-Amino-3-[5-[Bis(2-Chloroethyl)Amino]-2-Methylphenyl]Propanoic Acid No suppilers available for the product. |
| Name | (2S)-2-Amino-3-[5-[Bis(2-Chloroethyl)Amino]-2-Methylphenyl]Propanoic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-3-[5-[Bis(2-Chloroethyl)Amino]-2-Methyl-Phenyl]Propanoic Acid; (2S)-2-Amino-3-[5-[Bis(2-Chloroethyl)Amino]-2-Methyl-Phenyl]Propionic Acid; 2-Methyl-5-Bis(Beta-Chloroethyl)Aminophenylalanine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 |
| CAS Registry Number | 74980-06-6 |
| SMILES | [C@H](C(=O)O)(N)CC1=CC(=CC=C1C)N(CCCl)CCCl |
| InChI | 1S/C14H20Cl2N2O2/c1-10-2-3-12(18(6-4-15)7-5-16)8-11(10)9-13(17)14(19)20/h2-3,8,13H,4-7,9,17H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | UUTGSFMMHKOJCA-ZDUSSCGKSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.028°C at 760 mmHg (Cal.) |
| Flash point | 259.836°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-3-[5-[Bis(2-Chloroethyl)Amino]-2-Methylphenyl]Propanoic Acid |