|
CAS#: 74985-82-3 Product: 9alpha-O-Methylmitomycin B No suppilers available for the product. |
| Name | 9alpha-O-Methylmitomycin B |
|---|---|
| Synonyms | Azirino(2',3':3,4)Pyrrolo(1,2-A)Indole-4,7-Dione, 1,1A,2,8,8A,8B-Hexahydro-6,8A-; Azirino(2',3':3,4)Pyrrolo(1,2-A)Indole-4,7-Dione, 1,1A,2,8,8A,8B-Hexahydro-6,8A-Dimethoxy-1,5-Dimethyl-8-(Hydroxymethyl)-, Carbamate; Brn 5485913 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 |
| CAS Registry Number | 74985-82-3 |
| SMILES | [C@]13(OC)N(C2=C([C@H]1COC(=O)N)C(=O)C(=C(C2=O)C)OC)CC4N(C34)C |
| InChI | 1S/C17H21N3O6/c1-7-12(21)11-10(13(22)14(7)24-3)8(6-26-16(18)23)17(25-4)15-9(19(15)2)5-20(11)17/h8-9,15H,5-6H2,1-4H3,(H2,18,23)/t8-,9?,15?,17-,19?/m1/s1 |
| InChIKey | FMMDHGNWABITNT-QTGYQSILSA-N |
| Density | 1.469g/cm3 (Cal.) |
|---|---|
| Boiling point | 567.966°C at 760 mmHg (Cal.) |
| Flash point | 297.296°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9alpha-O-Methylmitomycin B |