|
CAS#: 7506-00-5 Product: 1-(9,10-Dihydrophenanthren-2-Yl)Propan-1-One No suppilers available for the product. |
| Name | 1-(9,10-Dihydrophenanthren-2-Yl)Propan-1-One |
|---|---|
| Synonyms | Nsc402390 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 |
| CAS Registry Number | 7506-00-5 |
| SMILES | C1=CC2=C(C=C1C(CC)=O)CCC3=C2C=CC=C3 |
| InChI | 1S/C17H16O/c1-2-17(18)14-9-10-16-13(11-14)8-7-12-5-3-4-6-15(12)16/h3-6,9-11H,2,7-8H2,1H3 |
| InChIKey | VSHYXKJOCNMIBU-UHFFFAOYSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.536°C at 760 mmHg (Cal.) |
| Flash point | 177.803°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(9,10-Dihydrophenanthren-2-Yl)Propan-1-One |