|
CAS#: 7506-91-4 Product: (2-Ethyl-1-Hydroxyhexyl)Phosphonic Acid No suppilers available for the product. |
| Name | (2-Ethyl-1-Hydroxyhexyl)Phosphonic Acid |
|---|---|
| Synonyms | (2-Ethyl-1-Hydroxy-Hexyl)Phosphonic Acid; Nsc407838; Phosphonic Acid, (2-Ethyl-1-Hydroxyhexyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19O4P |
| Molecular Weight | 210.21 |
| CAS Registry Number | 7506-91-4 |
| SMILES | C(C)CCC(CC)C(O)[P](=O)(O)O |
| InChI | 1S/C8H19O4P/c1-3-5-6-7(4-2)8(9)13(10,11)12/h7-9H,3-6H2,1-2H3,(H2,10,11,12) |
| InChIKey | GLYRBOZDGLTONH-UHFFFAOYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.926°C at 760 mmHg (Cal.) |
| Flash point | 173.897°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Ethyl-1-Hydroxyhexyl)Phosphonic Acid |