|
CAS#: 7508-30-7 Product: 3,4-Dihydro-2-(4-Hydroxyphenyl)-2H-1-Benzopyran-4-Ol No suppilers available for the product. |
| Name | 3,4-Dihydro-2-(4-Hydroxyphenyl)-2H-1-Benzopyran-4-Ol |
|---|---|
| Synonyms | 2-(4-Hydroxyphenyl)-4-Chromanol; Nsc 401496; 4,4'-Flavandiol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 7508-30-7 |
| SMILES | C1=CC2=C(C=C1)C(O)CC(O2)C3=CC=C(C=C3)O |
| InChI | 1S/C15H14O3/c16-11-7-5-10(6-8-11)15-9-13(17)12-3-1-2-4-14(12)18-15/h1-8,13,15-17H,9H2 |
| InChIKey | VIWWLMUBPMSXTF-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.875°C at 760 mmHg (Cal.) |
| Flash point | 221.643°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-2-(4-Hydroxyphenyl)-2H-1-Benzopyran-4-Ol |