|
CAS#: 7508-83-0 Product: 2-Methoxy-3,3-Dimethyl-2-[4-(4-Nitrophenyl)Phenyl]Oxirane No suppilers available for the product. |
| Name | 2-Methoxy-3,3-Dimethyl-2-[4-(4-Nitrophenyl)Phenyl]Oxirane |
|---|---|
| Synonyms | Nsc407110 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 |
| CAS Registry Number | 7508-83-0 |
| SMILES | C1=CC(=CC=C1C3=CC=C(C2(C(C)(C)O2)OC)C=C3)[N+]([O-])=O |
| InChI | 1S/C17H17NO4/c1-16(2)17(21-3,22-16)14-8-4-12(5-9-14)13-6-10-15(11-7-13)18(19)20/h4-11H,1-3H3 |
| InChIKey | IBKUAHHHJMVQLB-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.362°C at 760 mmHg (Cal.) |
| Flash point | 170.501°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-3,3-Dimethyl-2-[4-(4-Nitrophenyl)Phenyl]Oxirane |